C14H14N2 — CID 139926182
4-(2,6-dimethyl-1,4-dihydropyridin-4-yl)benzonitrile (PubChem CID 139926182) has the molecular formula C14H14N2 and a molecular weight of 210.28 g/mol. Its IUPAC name is 4-(2,6-dimethyl-1,4-dihydropyridin-4-yl)benzonitrile.
| Compound Name | 4-(2,6-dimethyl-1,4-dihydropyridin-4-yl)benzonitrile |
|---|---|
| PubChem CID | 139926182 |
| Molecular Formula | C14H14N2 |
| Molecular Weight | 210.28 g/mol |
| Exact Mass | 210.12 |
| IUPAC Name | 4-(2,6-dimethyl-1,4-dihydropyridin-4-yl)benzonitrile |
| SMILES | CC1=CC(c2ccc(C#N)cc2)C=C(C)N1 |
| InChI | InChI=1S/C14H14N2/c1-10-7-14(8-11(2)16-10)13-5-3-12(9-15)4-6-13/h3-8,14,16H,1-2H3 |
| InChIKey | JOOTZTCMEDQJHB-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 35.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.28 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |