C14H18N2 — CID 125469118
4-[(2R)-4,4-dimethylpiperidin-2-yl]benzonitrile (PubChem CID 125469118) has the molecular formula C14H18N2 and a molecular weight of 214.31 g/mol. Its IUPAC name is 4-[(2R)-4,4-dimethylpiperidin-2-yl]benzonitrile.
| Compound Name | 4-[(2R)-4,4-dimethylpiperidin-2-yl]benzonitrile |
|---|---|
| PubChem CID | 125469118 |
| Molecular Formula | C14H18N2 |
| Molecular Weight | 214.31 g/mol |
| Exact Mass | 214.15 |
| IUPAC Name | 4-[(2R)-4,4-dimethylpiperidin-2-yl]benzonitrile |
| SMILES | CC1(C)CCN[C@@H](c2ccc(C#N)cc2)C1 |
| InChI | InChI=1S/C14H18N2/c1-14(2)7-8-16-13(9-14)12-5-3-11(10-15)4-6-12/h3-6,13,16H,7-9H2,1-2H3/t13-/m1/s1 |
| InChIKey | DPCYTXMLYSPLPA-CYBMUJFWSA-N |
| XLogP | 3.01 |
| TPSA | 35.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.31 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |