About 4-hydroxybenzonitrile
4-hydroxybenzonitrile (PubChem CID 53435365) has the molecular formula C14H10N2O2
and a molecular weight of 238.25 g/mol. Its IUPAC name is 4-hydroxybenzonitrile.
Molecular Properties
| Compound Name | 4-hydroxybenzonitrile |
| PubChem CID | 53435365 |
| Molecular Formula | C14H10N2O2 |
| Molecular Weight | 238.25 g/mol |
| Exact Mass | 238.07 |
| IUPAC Name | 4-hydroxybenzonitrile |
| SMILES | N#Cc1ccc(O)cc1.N#Cc1ccc(O)cc1 |
| InChI | InChI=1S/2C7H5NO/c2*8-5-6-1-3-7(9)4-2-6/h2*1-4,9H |
| InChIKey | NZAYZRTUFJDPKK-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 88.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 238.25 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 4-hydroxybenzonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-hydroxybenzonitrile?
The IUPAC name of 4-hydroxybenzonitrile (CID 53435365) is 4-hydroxybenzonitrile.
What is the SMILES notation for 4-hydroxybenzonitrile?
The canonical SMILES for 4-hydroxybenzonitrile is N#Cc1ccc(O)cc1.N#Cc1ccc(O)cc1.
What is the InChIKey of 4-hydroxybenzonitrile?
The InChIKey is NZAYZRTUFJDPKK-UHFFFAOYSA-N. The full InChI is InChI=1S/2C7H5NO/c2*8-5-6-1-3-7(9)4-2-6/h2*1-4,9H.
What are the key properties of 4-hydroxybenzonitrile?
4-hydroxybenzonitrile has a molecular weight of 238.25 g/mol, XLogP of 2.53, 0 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-hydroxybenzonitrile is sourced from PubChem (CID 53435365), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).