C13H9F2NO2 — CID 174859454
2,4-difluorophenol;4-hydroxybenzonitrile (PubChem CID 174859454) has the molecular formula C13H9F2NO2 and a molecular weight of 249.22 g/mol. Its IUPAC name is 2,4-difluorophenol;4-hydroxybenzonitrile.
| Compound Name | 2,4-difluorophenol;4-hydroxybenzonitrile |
|---|---|
| PubChem CID | 174859454 |
| Molecular Formula | C13H9F2NO2 |
| Molecular Weight | 249.22 g/mol |
| Exact Mass | 249.06 |
| IUPAC Name | 2,4-difluorophenol;4-hydroxybenzonitrile |
| SMILES | N#Cc1ccc(O)cc1.Oc1ccc(F)cc1F |
| InChI | InChI=1S/C7H5NO.C6H4F2O/c8-5-6-1-3-7(9)4-2-6;7-4-1-2-6(9)5(8)3-4/h1-4,9H;1-3,9H |
| InChIKey | OGYPFTHPYXIVQP-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 64.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.22 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |