C13H7F2NO — CID 63269334
4-(2,5-difluorophenoxy)benzonitrile (PubChem CID 63269334) has the molecular formula C13H7F2NO and a molecular weight of 231.20 g/mol. Its IUPAC name is 4-(2,5-difluorophenoxy)benzonitrile.
| Compound Name | 4-(2,5-difluorophenoxy)benzonitrile |
|---|---|
| PubChem CID | 63269334 |
| Molecular Formula | C13H7F2NO |
| Molecular Weight | 231.20 g/mol |
| Exact Mass | 231.05 |
| IUPAC Name | 4-(2,5-difluorophenoxy)benzonitrile |
| SMILES | N#Cc1ccc(Oc2cc(F)ccc2F)cc1 |
| InChI | InChI=1S/C13H7F2NO/c14-10-3-6-12(15)13(7-10)17-11-4-1-9(8-16)2-5-11/h1-7H |
| InChIKey | VBQLHFGPUKXJPD-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 33.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.20 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |