C13H6F2INO3S — CID 89020213
5-cyano-2-(2,5-difluorophenoxy)benzenesulfonyl iodide (PubChem CID 89020213) has the molecular formula C13H6F2INO3S and a molecular weight of 421.16 g/mol. Its IUPAC name is 5-cyano-2-(2,5-difluorophenoxy)benzenesulfonyl iodide.
| Compound Name | 5-cyano-2-(2,5-difluorophenoxy)benzenesulfonyl iodide |
|---|---|
| PubChem CID | 89020213 |
| Molecular Formula | C13H6F2INO3S |
| Molecular Weight | 421.16 g/mol |
| Exact Mass | 420.91 |
| IUPAC Name | 5-cyano-2-(2,5-difluorophenoxy)benzenesulfonyl iodide |
| SMILES | N#Cc1ccc(Oc2cc(F)ccc2F)c(S(=O)(=O)I)c1 |
| InChI | InChI=1S/C13H6F2INO3S/c14-9-2-3-10(15)12(6-9)20-11-4-1-8(7-17)5-13(11)21(16,18)19/h1-6H |
| InChIKey | QSNLMJKZQWOPFM-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 67.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.16 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|