C12H6F2N2O — CID 113320711
5-(2,5-difluorophenoxy)pyridine-2-carbonitrile (PubChem CID 113320711) has the molecular formula C12H6F2N2O and a molecular weight of 232.19 g/mol. Its IUPAC name is 5-(2,5-difluorophenoxy)pyridine-2-carbonitrile.
| Compound Name | 5-(2,5-difluorophenoxy)pyridine-2-carbonitrile |
|---|---|
| PubChem CID | 113320711 |
| Molecular Formula | C12H6F2N2O |
| Molecular Weight | 232.19 g/mol |
| Exact Mass | 232.04 |
| IUPAC Name | 5-(2,5-difluorophenoxy)pyridine-2-carbonitrile |
| SMILES | N#Cc1ccc(Oc2cc(F)ccc2F)cn1 |
| InChI | InChI=1S/C12H6F2N2O/c13-8-1-4-11(14)12(5-8)17-10-3-2-9(6-15)16-7-10/h1-5,7H |
| InChIKey | AYOOVBZMGTUBRA-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 45.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.19 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |