C12H7ClF2O — CID 141112075
2-(4-chlorophenoxy)-1,4-difluorobenzene (PubChem CID 141112075) has the molecular formula C12H7ClF2O and a molecular weight of 240.64 g/mol. Its IUPAC name is 2-(4-chlorophenoxy)-1,4-difluorobenzene.
| Compound Name | 2-(4-chlorophenoxy)-1,4-difluorobenzene |
|---|---|
| PubChem CID | 141112075 |
| Molecular Formula | C12H7ClF2O |
| Molecular Weight | 240.64 g/mol |
| Exact Mass | 240.02 |
| IUPAC Name | 2-(4-chlorophenoxy)-1,4-difluorobenzene |
| SMILES | Fc1ccc(F)c(Oc2ccc(Cl)cc2)c1 |
| InChI | InChI=1S/C12H7ClF2O/c13-8-1-4-10(5-2-8)16-12-7-9(14)3-6-11(12)15/h1-7H |
| InChIKey | FEHMMRFIBSKCPY-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.64 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |