C16H17ClFNO2 — CID 155988336
2-[2-(4-chlorophenoxy)-5-fluorophenoxy]-N,N-dimethylethanamine (PubChem CID 155988336) has the molecular formula C16H17ClFNO2 and a molecular weight of 309.77 g/mol. Its IUPAC name is 2-[2-(4-chlorophenoxy)-5-fluorophenoxy]-N,N-dimethylethanamine.
| Compound Name | 2-[2-(4-chlorophenoxy)-5-fluorophenoxy]-N,N-dimethylethanamine |
|---|---|
| PubChem CID | 155988336 |
| Molecular Formula | C16H17ClFNO2 |
| Molecular Weight | 309.77 g/mol |
| Exact Mass | 309.09 |
| IUPAC Name | 2-[2-(4-chlorophenoxy)-5-fluorophenoxy]-N,N-dimethylethanamine |
| SMILES | CN(C)CCOc1cc(F)ccc1Oc1ccc(Cl)cc1 |
| InChI | InChI=1S/C16H17ClFNO2/c1-19(2)9-10-20-16-11-13(18)5-8-15(16)21-14-6-3-12(17)4-7-14/h3-8,11H,9-10H2,1-2H3 |
| InChIKey | XPGGUAQLRGMHEI-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.77 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |