C17H15ClFNO3 — CID 139462484
2-chloro-4-[2-(dimethylamino)ethoxy]-6-fluoroxanthen-9-one (PubChem CID 139462484) has the molecular formula C17H15ClFNO3 and a molecular weight of 335.76 g/mol. Its IUPAC name is 2-chloro-4-[2-(dimethylamino)ethoxy]-6-fluoroxanthen-9-one.
| Compound Name | 2-chloro-4-[2-(dimethylamino)ethoxy]-6-fluoroxanthen-9-one |
|---|---|
| PubChem CID | 139462484 |
| Molecular Formula | C17H15ClFNO3 |
| Molecular Weight | 335.76 g/mol |
| Exact Mass | 335.07 |
| IUPAC Name | 2-chloro-4-[2-(dimethylamino)ethoxy]-6-fluoroxanthen-9-one |
| SMILES | CN(C)CCOc1cc(Cl)cc2c(=O)c3ccc(F)cc3oc12 |
| InChI | InChI=1S/C17H15ClFNO3/c1-20(2)5-6-22-15-8-10(18)7-13-16(21)12-4-3-11(19)9-14(12)23-17(13)15/h3-4,7-9H,5-6H2,1-2H3 |
| InChIKey | YCTXRESBESHRMR-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 42.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.76 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|