C32H30N2O5 — CID 139462429
3-[5-[3-(dimethylamino)propoxy]-7-methyl-9-oxoxanthen-3-yl]oxy-N-phenylbenzamide (PubChem CID 139462429) has the molecular formula C32H30N2O5 and a molecular weight of 522.60 g/mol. Its IUPAC name is 3-[5-[3-(dimethylamino)propoxy]-7-methyl-9-oxoxanthen-3-yl]oxy-N-phenylbenzamide.
| Compound Name | 3-[5-[3-(dimethylamino)propoxy]-7-methyl-9-oxoxanthen-3-yl]oxy-N-phenylbenzamide |
|---|---|
| PubChem CID | 139462429 |
| Molecular Formula | C32H30N2O5 |
| Molecular Weight | 522.60 g/mol |
| Exact Mass | 522.22 |
| IUPAC Name | 3-[5-[3-(dimethylamino)propoxy]-7-methyl-9-oxoxanthen-3-yl]oxy-N-phenylbenzamide |
| SMILES | Cc1cc(OCCCN(C)C)c2oc3cc(Oc4cccc(C(=O)Nc5ccccc5)c4)ccc3c(=O)c2c1 |
| InChI | InChI=1S/C32H30N2O5/c1-21-17-27-30(35)26-14-13-25(20-28(26)39-31(27)29(18-21)37-16-8-15-34(2)3)38-24-12-7-9-22(19-24)32(36)33-23-10-5-4-6-11-23/h4-7,9-14,17-20H,8,15-16H2,1-3H3,(H,33,36) |
| InChIKey | VXZAWULSRVYKGZ-UHFFFAOYSA-N |
| XLogP | 6.63 |
| TPSA | 81.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.60 |
| LogP ≤ 5 | 6.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|