C26H25NO4 — CID 23471925
4-butoxy-N-(5,7-dimethyl-9-oxoxanthen-3-yl)benzamide (PubChem CID 23471925) has the molecular formula C26H25NO4 and a molecular weight of 415.49 g/mol. Its IUPAC name is 4-butoxy-N-(5,7-dimethyl-9-oxoxanthen-3-yl)benzamide.
| Compound Name | 4-butoxy-N-(5,7-dimethyl-9-oxoxanthen-3-yl)benzamide |
|---|---|
| PubChem CID | 23471925 |
| Molecular Formula | C26H25NO4 |
| Molecular Weight | 415.49 g/mol |
| Exact Mass | 415.18 |
| IUPAC Name | 4-butoxy-N-(5,7-dimethyl-9-oxoxanthen-3-yl)benzamide |
| SMILES | CCCCOc1ccc(C(=O)Nc2ccc3c(=O)c4cc(C)cc(C)c4oc3c2)cc1 |
| InChI | InChI=1S/C26H25NO4/c1-4-5-12-30-20-9-6-18(7-10-20)26(29)27-19-8-11-21-23(15-19)31-25-17(3)13-16(2)14-22(25)24(21)28/h6-11,13-15H,4-5,12H2,1-3H3,(H,27,29) |
| InChIKey | GIPCBCZYDQOZHR-UHFFFAOYSA-N |
| XLogP | 5.99 |
| TPSA | 68.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.49 |
| LogP ≤ 5 | 5.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|