C29H29NO5 — CID 108754323
4-hexoxy-N-[4-(6-methoxy-4-oxochromen-2-yl)phenyl]benzamide (PubChem CID 108754323) has the molecular formula C29H29NO5 and a molecular weight of 471.55 g/mol. Its IUPAC name is 4-hexoxy-N-[4-(6-methoxy-4-oxochromen-2-yl)phenyl]benzamide.
| Compound Name | 4-hexoxy-N-[4-(6-methoxy-4-oxochromen-2-yl)phenyl]benzamide |
|---|---|
| PubChem CID | 108754323 |
| Molecular Formula | C29H29NO5 |
| Molecular Weight | 471.55 g/mol |
| Exact Mass | 471.20 |
| IUPAC Name | 4-hexoxy-N-[4-(6-methoxy-4-oxochromen-2-yl)phenyl]benzamide |
| SMILES | CCCCCCOc1ccc(C(=O)Nc2ccc(-c3cc(=O)c4cc(OC)ccc4o3)cc2)cc1 |
| InChI | InChI=1S/C29H29NO5/c1-3-4-5-6-17-34-23-13-9-21(10-14-23)29(32)30-22-11-7-20(8-12-22)28-19-26(31)25-18-24(33-2)15-16-27(25)35-28/h7-16,18-19H,3-6,17H2,1-2H3,(H,30,32) |
| InChIKey | VUKAEHZEIANFKN-UHFFFAOYSA-N |
| XLogP | 6.68 |
| TPSA | 77.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.55 |
| LogP ≤ 5 | 6.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|