C24H19NO3 — CID 108790164
4-(6-methyl-4-oxochromen-2-yl)-N-(4-methylphenyl)benzamide (PubChem CID 108790164) has the molecular formula C24H19NO3 and a molecular weight of 369.42 g/mol. Its IUPAC name is 4-(6-methyl-4-oxochromen-2-yl)-N-(4-methylphenyl)benzamide.
| Compound Name | 4-(6-methyl-4-oxochromen-2-yl)-N-(4-methylphenyl)benzamide |
|---|---|
| PubChem CID | 108790164 |
| Molecular Formula | C24H19NO3 |
| Molecular Weight | 369.42 g/mol |
| Exact Mass | 369.14 |
| IUPAC Name | 4-(6-methyl-4-oxochromen-2-yl)-N-(4-methylphenyl)benzamide |
| SMILES | Cc1ccc(NC(=O)c2ccc(-c3cc(=O)c4cc(C)ccc4o3)cc2)cc1 |
| InChI | InChI=1S/C24H19NO3/c1-15-3-10-19(11-4-15)25-24(27)18-8-6-17(7-9-18)23-14-21(26)20-13-16(2)5-12-22(20)28-23/h3-14H,1-2H3,(H,25,27) |
| InChIKey | YKSUDUWHADGAIX-UHFFFAOYSA-N |
| XLogP | 5.33 |
| TPSA | 59.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.42 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |