C23H14F3NO3 — CID 108803013
4-(6-methyl-4-oxochromen-2-yl)-N-(2,3,4-trifluorophenyl)benzamide (PubChem CID 108803013) has the molecular formula C23H14F3NO3 and a molecular weight of 409.36 g/mol. Its IUPAC name is 4-(6-methyl-4-oxochromen-2-yl)-N-(2,3,4-trifluorophenyl)benzamide.
| Compound Name | 4-(6-methyl-4-oxochromen-2-yl)-N-(2,3,4-trifluorophenyl)benzamide |
|---|---|
| PubChem CID | 108803013 |
| Molecular Formula | C23H14F3NO3 |
| Molecular Weight | 409.36 g/mol |
| Exact Mass | 409.09 |
| IUPAC Name | 4-(6-methyl-4-oxochromen-2-yl)-N-(2,3,4-trifluorophenyl)benzamide |
| SMILES | Cc1ccc2oc(-c3ccc(C(=O)Nc4ccc(F)c(F)c4F)cc3)cc(=O)c2c1 |
| InChI | InChI=1S/C23H14F3NO3/c1-12-2-9-19-15(10-12)18(28)11-20(30-19)13-3-5-14(6-4-13)23(29)27-17-8-7-16(24)21(25)22(17)26/h2-11H,1H3,(H,27,29) |
| InChIKey | JNDJRWBSYFAJRF-UHFFFAOYSA-N |
| XLogP | 5.44 |
| TPSA | 59.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.36 |
| LogP ≤ 5 | 5.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|