C26H18N2O3 — CID 108790350
4-(6-methyl-4-oxochromen-2-yl)-N-quinolin-8-ylbenzamide (PubChem CID 108790350) has the molecular formula C26H18N2O3 and a molecular weight of 406.44 g/mol. Its IUPAC name is 4-(6-methyl-4-oxochromen-2-yl)-N-quinolin-8-ylbenzamide.
| Compound Name | 4-(6-methyl-4-oxochromen-2-yl)-N-quinolin-8-ylbenzamide |
|---|---|
| PubChem CID | 108790350 |
| Molecular Formula | C26H18N2O3 |
| Molecular Weight | 406.44 g/mol |
| Exact Mass | 406.13 |
| IUPAC Name | 4-(6-methyl-4-oxochromen-2-yl)-N-quinolin-8-ylbenzamide |
| SMILES | Cc1ccc2oc(-c3ccc(C(=O)Nc4cccc5cccnc45)cc3)cc(=O)c2c1 |
| InChI | InChI=1S/C26H18N2O3/c1-16-7-12-23-20(14-16)22(29)15-24(31-23)17-8-10-19(11-9-17)26(30)28-21-6-2-4-18-5-3-13-27-25(18)21/h2-15H,1H3,(H,28,30) |
| InChIKey | LMVCRZDBAMRKLE-UHFFFAOYSA-N |
| XLogP | 5.57 |
| TPSA | 72.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.44 |
| LogP ≤ 5 | 5.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |