C30H24N2O3 — CID 108803154
N-[2-(4-methylanilino)phenyl]-4-(6-methyl-4-oxochromen-2-yl)benzamide (PubChem CID 108803154) has the molecular formula C30H24N2O3 and a molecular weight of 460.53 g/mol. Its IUPAC name is N-[2-(4-methylanilino)phenyl]-4-(6-methyl-4-oxochromen-2-yl)benzamide.
| Compound Name | N-[2-(4-methylanilino)phenyl]-4-(6-methyl-4-oxochromen-2-yl)benzamide |
|---|---|
| PubChem CID | 108803154 |
| Molecular Formula | C30H24N2O3 |
| Molecular Weight | 460.53 g/mol |
| Exact Mass | 460.18 |
| IUPAC Name | N-[2-(4-methylanilino)phenyl]-4-(6-methyl-4-oxochromen-2-yl)benzamide |
| SMILES | Cc1ccc(Nc2ccccc2NC(=O)c2ccc(-c3cc(=O)c4cc(C)ccc4o3)cc2)cc1 |
| InChI | InChI=1S/C30H24N2O3/c1-19-7-14-23(15-8-19)31-25-5-3-4-6-26(25)32-30(34)22-12-10-21(11-13-22)29-18-27(33)24-17-20(2)9-16-28(24)35-29/h3-18,31H,1-2H3,(H,32,34) |
| InChIKey | UKPKVHGOZTYMOF-UHFFFAOYSA-N |
| XLogP | 7.07 |
| TPSA | 71.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.53 |
| LogP ≤ 5 | 7.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |