C18H12F3NO4 — CID 108754281
2,2,2-trifluoro-N-[4-(6-methoxy-4-oxochromen-2-yl)phenyl]acetamide (PubChem CID 108754281) has the molecular formula C18H12F3NO4 and a molecular weight of 363.29 g/mol. Its IUPAC name is 2,2,2-trifluoro-N-[4-(6-methoxy-4-oxochromen-2-yl)phenyl]acetamide.
| Compound Name | 2,2,2-trifluoro-N-[4-(6-methoxy-4-oxochromen-2-yl)phenyl]acetamide |
|---|---|
| PubChem CID | 108754281 |
| Molecular Formula | C18H12F3NO4 |
| Molecular Weight | 363.29 g/mol |
| Exact Mass | 363.07 |
| IUPAC Name | 2,2,2-trifluoro-N-[4-(6-methoxy-4-oxochromen-2-yl)phenyl]acetamide |
| SMILES | COc1ccc2oc(-c3ccc(NC(=O)C(F)(F)F)cc3)cc(=O)c2c1 |
| InChI | InChI=1S/C18H12F3NO4/c1-25-12-6-7-15-13(8-12)14(23)9-16(26-15)10-2-4-11(5-3-10)22-17(24)18(19,20)21/h2-9H,1H3,(H,22,24) |
| InChIKey | QXNFMCOCLUINAD-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 68.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.29 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |