C27H20N2O6 — CID 108754317
2-(1,3-dioxoisoindol-2-yl)-N-[4-(6-methoxy-4-oxochromen-2-yl)phenyl]propanamide (PubChem CID 108754317) has the molecular formula C27H20N2O6 and a molecular weight of 468.47 g/mol. Its IUPAC name is 2-(1,3-dioxoisoindol-2-yl)-N-[4-(6-methoxy-4-oxochromen-2-yl)phenyl]propanamide.
| Compound Name | 2-(1,3-dioxoisoindol-2-yl)-N-[4-(6-methoxy-4-oxochromen-2-yl)phenyl]propanamide |
|---|---|
| PubChem CID | 108754317 |
| Molecular Formula | C27H20N2O6 |
| Molecular Weight | 468.47 g/mol |
| Exact Mass | 468.13 |
| IUPAC Name | 2-(1,3-dioxoisoindol-2-yl)-N-[4-(6-methoxy-4-oxochromen-2-yl)phenyl]propanamide |
| SMILES | COc1ccc2oc(-c3ccc(NC(=O)C(C)N4C(=O)c5ccccc5C4=O)cc3)cc(=O)c2c1 |
| InChI | InChI=1S/C27H20N2O6/c1-15(29-26(32)19-5-3-4-6-20(19)27(29)33)25(31)28-17-9-7-16(8-10-17)24-14-22(30)21-13-18(34-2)11-12-23(21)35-24/h3-15H,1-2H3,(H,28,31) |
| InChIKey | PYZLJGBIBVMGFQ-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 105.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.47 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|