C25H23NO4 — CID 23471992
N-(6,7-dimethyl-9-oxoxanthen-3-yl)-4-propoxybenzamide (PubChem CID 23471992) has the molecular formula C25H23NO4 and a molecular weight of 401.46 g/mol. Its IUPAC name is N-(6,7-dimethyl-9-oxoxanthen-3-yl)-4-propoxybenzamide.
| Compound Name | N-(6,7-dimethyl-9-oxoxanthen-3-yl)-4-propoxybenzamide |
|---|---|
| PubChem CID | 23471992 |
| Molecular Formula | C25H23NO4 |
| Molecular Weight | 401.46 g/mol |
| Exact Mass | 401.16 |
| IUPAC Name | N-(6,7-dimethyl-9-oxoxanthen-3-yl)-4-propoxybenzamide |
| SMILES | CCCOc1ccc(C(=O)Nc2ccc3c(=O)c4cc(C)c(C)cc4oc3c2)cc1 |
| InChI | InChI=1S/C25H23NO4/c1-4-11-29-19-8-5-17(6-9-19)25(28)26-18-7-10-20-23(14-18)30-22-13-16(3)15(2)12-21(22)24(20)27/h5-10,12-14H,4,11H2,1-3H3,(H,26,28) |
| InChIKey | ZDAQDEJPUCYBNI-UHFFFAOYSA-N |
| XLogP | 5.60 |
| TPSA | 68.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.46 |
| LogP ≤ 5 | 5.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|