C26H25NO4 — CID 23472134
2-(4-tert-butylphenoxy)-N-(5-methyl-9-oxoxanthen-3-yl)acetamide (PubChem CID 23472134) has the molecular formula C26H25NO4 and a molecular weight of 415.49 g/mol. Its IUPAC name is 2-(4-tert-butylphenoxy)-N-(5-methyl-9-oxoxanthen-3-yl)acetamide.
| Compound Name | 2-(4-tert-butylphenoxy)-N-(5-methyl-9-oxoxanthen-3-yl)acetamide |
|---|---|
| PubChem CID | 23472134 |
| Molecular Formula | C26H25NO4 |
| Molecular Weight | 415.49 g/mol |
| Exact Mass | 415.18 |
| IUPAC Name | 2-(4-tert-butylphenoxy)-N-(5-methyl-9-oxoxanthen-3-yl)acetamide |
| SMILES | Cc1cccc2c(=O)c3ccc(NC(=O)COc4ccc(C(C)(C)C)cc4)cc3oc12 |
| InChI | InChI=1S/C26H25NO4/c1-16-6-5-7-21-24(29)20-13-10-18(14-22(20)31-25(16)21)27-23(28)15-30-19-11-8-17(9-12-19)26(2,3)4/h5-14H,15H2,1-4H3,(H,27,28) |
| InChIKey | NLGRSUUROSAATF-UHFFFAOYSA-N |
| XLogP | 5.57 |
| TPSA | 68.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.49 |
| LogP ≤ 5 | 5.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|