C25H22ClNO4 — CID 23472212
2-(4-tert-butylphenoxy)-N-(5-chloro-9-oxoxanthen-3-yl)acetamide (PubChem CID 23472212) has the molecular formula C25H22ClNO4 and a molecular weight of 435.91 g/mol. Its IUPAC name is 2-(4-tert-butylphenoxy)-N-(5-chloro-9-oxoxanthen-3-yl)acetamide.
| Compound Name | 2-(4-tert-butylphenoxy)-N-(5-chloro-9-oxoxanthen-3-yl)acetamide |
|---|---|
| PubChem CID | 23472212 |
| Molecular Formula | C25H22ClNO4 |
| Molecular Weight | 435.91 g/mol |
| Exact Mass | 435.12 |
| IUPAC Name | 2-(4-tert-butylphenoxy)-N-(5-chloro-9-oxoxanthen-3-yl)acetamide |
| SMILES | CC(C)(C)c1ccc(OCC(=O)Nc2ccc3c(=O)c4cccc(Cl)c4oc3c2)cc1 |
| InChI | InChI=1S/C25H22ClNO4/c1-25(2,3)15-7-10-17(11-8-15)30-14-22(28)27-16-9-12-18-21(13-16)31-24-19(23(18)29)5-4-6-20(24)26/h4-13H,14H2,1-3H3,(H,27,28) |
| InChIKey | RXYGTVXDZRQVBO-UHFFFAOYSA-N |
| XLogP | 5.91 |
| TPSA | 68.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.91 |
| LogP ≤ 5 | 5.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|