C24H20ClNO4 — CID 23471876
N-(7-chloro-6-methyl-9-oxoxanthen-3-yl)-2-(3,4-dimethylphenoxy)acetamide (PubChem CID 23471876) has the molecular formula C24H20ClNO4 and a molecular weight of 421.88 g/mol. Its IUPAC name is N-(7-chloro-6-methyl-9-oxoxanthen-3-yl)-2-(3,4-dimethylphenoxy)acetamide.
| Compound Name | N-(7-chloro-6-methyl-9-oxoxanthen-3-yl)-2-(3,4-dimethylphenoxy)acetamide |
|---|---|
| PubChem CID | 23471876 |
| Molecular Formula | C24H20ClNO4 |
| Molecular Weight | 421.88 g/mol |
| Exact Mass | 421.11 |
| IUPAC Name | N-(7-chloro-6-methyl-9-oxoxanthen-3-yl)-2-(3,4-dimethylphenoxy)acetamide |
| SMILES | Cc1ccc(OCC(=O)Nc2ccc3c(=O)c4cc(Cl)c(C)cc4oc3c2)cc1C |
| InChI | InChI=1S/C24H20ClNO4/c1-13-4-6-17(8-14(13)2)29-12-23(27)26-16-5-7-18-22(10-16)30-21-9-15(3)20(25)11-19(21)24(18)28/h4-11H,12H2,1-3H3,(H,26,27) |
| InChIKey | LSQQGLKRMZVDGN-UHFFFAOYSA-N |
| XLogP | 5.54 |
| TPSA | 68.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.88 |
| LogP ≤ 5 | 5.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|