C23H19NO4 — CID 23472176
2-(4-ethylphenoxy)-N-(9-oxoxanthen-3-yl)acetamide (PubChem CID 23472176) has the molecular formula C23H19NO4 and a molecular weight of 373.41 g/mol. Its IUPAC name is 2-(4-ethylphenoxy)-N-(9-oxoxanthen-3-yl)acetamide.
| Compound Name | 2-(4-ethylphenoxy)-N-(9-oxoxanthen-3-yl)acetamide |
|---|---|
| PubChem CID | 23472176 |
| Molecular Formula | C23H19NO4 |
| Molecular Weight | 373.41 g/mol |
| Exact Mass | 373.13 |
| IUPAC Name | 2-(4-ethylphenoxy)-N-(9-oxoxanthen-3-yl)acetamide |
| SMILES | CCc1ccc(OCC(=O)Nc2ccc3c(=O)c4ccccc4oc3c2)cc1 |
| InChI | InChI=1S/C23H19NO4/c1-2-15-7-10-17(11-8-15)27-14-22(25)24-16-9-12-19-21(13-16)28-20-6-4-3-5-18(20)23(19)26/h3-13H,2,14H2,1H3,(H,24,25) |
| InChIKey | LHRQGFFCBPRHMV-UHFFFAOYSA-N |
| XLogP | 4.53 |
| TPSA | 68.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.41 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|