C23H18FNO4 — CID 23472081
2-(2,3-dimethylphenoxy)-N-(5-fluoro-9-oxoxanthen-3-yl)acetamide (PubChem CID 23472081) has the molecular formula C23H18FNO4 and a molecular weight of 391.40 g/mol. Its IUPAC name is 2-(2,3-dimethylphenoxy)-N-(5-fluoro-9-oxoxanthen-3-yl)acetamide.
| Compound Name | 2-(2,3-dimethylphenoxy)-N-(5-fluoro-9-oxoxanthen-3-yl)acetamide |
|---|---|
| PubChem CID | 23472081 |
| Molecular Formula | C23H18FNO4 |
| Molecular Weight | 391.40 g/mol |
| Exact Mass | 391.12 |
| IUPAC Name | 2-(2,3-dimethylphenoxy)-N-(5-fluoro-9-oxoxanthen-3-yl)acetamide |
| SMILES | Cc1cccc(OCC(=O)Nc2ccc3c(=O)c4cccc(F)c4oc3c2)c1C |
| InChI | InChI=1S/C23H18FNO4/c1-13-5-3-8-19(14(13)2)28-12-21(26)25-15-9-10-16-20(11-15)29-23-17(22(16)27)6-4-7-18(23)24/h3-11H,12H2,1-2H3,(H,25,26) |
| InChIKey | QCZDSRPPXHLHFC-UHFFFAOYSA-N |
| XLogP | 4.72 |
| TPSA | 68.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.40 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|