C46H41NO7 — CID 161171640
4-[2-(dimethylamino)ethoxy]-2-methyl-6-[3-(2-phenylacetyl)phenoxy]xanthen-9-one;1-(3-hydroxyphenyl)-2-phenylethanone (PubChem CID 161171640) has the molecular formula C46H41NO7 and a molecular weight of 719.83 g/mol. Its IUPAC name is 4-[2-(dimethylamino)ethoxy]-2-methyl-6-[3-(2-phenylacetyl)phenoxy]xanthen-9-one;1-(3-hydroxyphenyl)-2-phenylethanone.
| Compound Name | 4-[2-(dimethylamino)ethoxy]-2-methyl-6-[3-(2-phenylacetyl)phenoxy]xanthen-9-one;1-(3-hydroxyphenyl)-2-phenylethanone |
|---|---|
| PubChem CID | 161171640 |
| Molecular Formula | C46H41NO7 |
| Molecular Weight | 719.83 g/mol |
| Exact Mass | 719.29 |
| IUPAC Name | 4-[2-(dimethylamino)ethoxy]-2-methyl-6-[3-(2-phenylacetyl)phenoxy]xanthen-9-one;1-(3-hydroxyphenyl)-2-phenylethanone |
| SMILES | Cc1cc(OCCN(C)C)c2oc3cc(Oc4cccc(C(=O)Cc5ccccc5)c4)ccc3c(=O)c2c1.O=C(Cc1ccccc1)c1cccc(O)c1 |
| InChI | InChI=1S/C32H29NO5.C14H12O2/c1-21-16-27-31(35)26-13-12-25(20-29(26)38-32(27)30(17-21)36-15-14-33(2)3)37-24-11-7-10-23(19-24)28(34)18-22-8-5-4-6-9-22;15-13-8-4-7-12(10-13)14(16)9-11-5-2-1-3-6-11/h4-13,16-17,19-20H,14-15,18H2,1-3H3;1-8,10,15H,9H2 |
| InChIKey | URGIEJSVGZUBEW-UHFFFAOYSA-N |
| XLogP | 9.23 |
| TPSA | 106.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 719.83 |
| LogP ≤ 5 | 9.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|