C24H21BrO4 — CID 139462426
4-(4-bromobutoxy)-2-methyl-6-phenoxyxanthen-9-one (PubChem CID 139462426) has the molecular formula C24H21BrO4 and a molecular weight of 453.33 g/mol. Its IUPAC name is 4-(4-bromobutoxy)-2-methyl-6-phenoxyxanthen-9-one.
| Compound Name | 4-(4-bromobutoxy)-2-methyl-6-phenoxyxanthen-9-one |
|---|---|
| PubChem CID | 139462426 |
| Molecular Formula | C24H21BrO4 |
| Molecular Weight | 453.33 g/mol |
| Exact Mass | 452.06 |
| IUPAC Name | 4-(4-bromobutoxy)-2-methyl-6-phenoxyxanthen-9-one |
| SMILES | Cc1cc(OCCCCBr)c2oc3cc(Oc4ccccc4)ccc3c(=O)c2c1 |
| InChI | InChI=1S/C24H21BrO4/c1-16-13-20-23(26)19-10-9-18(28-17-7-3-2-4-8-17)15-21(19)29-24(20)22(14-16)27-12-6-5-11-25/h2-4,7-10,13-15H,5-6,11-12H2,1H3 |
| InChIKey | VRQORSUFUNYPQX-UHFFFAOYSA-N |
| XLogP | 6.60 |
| TPSA | 48.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.33 |
| LogP ≤ 5 | 6.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|