C34H39N3O5 — CID 139462257
N-cyclopentyl-3-[5-[7-methyl-5-[2-(1-methylpyrrolidin-2-yl)ethoxy]-9-oxoxanthen-3-yl]oxy-2-pyridinyl]propanamide (PubChem CID 139462257) has the molecular formula C34H39N3O5 and a molecular weight of 569.70 g/mol. Its IUPAC name is N-cyclopentyl-3-[5-[7-methyl-5-[2-(1-methylpyrrolidin-2-yl)ethoxy]-9-oxoxanthen-3-yl]oxy-2-pyridinyl]propanamide.
| Compound Name | N-cyclopentyl-3-[5-[7-methyl-5-[2-(1-methylpyrrolidin-2-yl)ethoxy]-9-oxoxanthen-3-yl]oxy-2-pyridinyl]propanamide |
|---|---|
| PubChem CID | 139462257 |
| Molecular Formula | C34H39N3O5 |
| Molecular Weight | 569.70 g/mol |
| Exact Mass | 569.29 |
| IUPAC Name | N-cyclopentyl-3-[5-[7-methyl-5-[2-(1-methylpyrrolidin-2-yl)ethoxy]-9-oxoxanthen-3-yl]oxy-2-pyridinyl]propanamide |
| SMILES | Cc1cc(OCCC2CCCN2C)c2oc3cc(Oc4ccc(CCC(=O)NC5CCCC5)nc4)ccc3c(=O)c2c1 |
| InChI | InChI=1S/C34H39N3O5/c1-22-18-29-33(39)28-13-12-26(20-30(28)42-34(29)31(19-22)40-17-15-25-8-5-16-37(25)2)41-27-11-9-23(35-21-27)10-14-32(38)36-24-6-3-4-7-24/h9,11-13,18-21,24-25H,3-8,10,14-17H2,1-2H3,(H,36,38) |
| InChIKey | YVUVMQPFXMKRQT-UHFFFAOYSA-N |
| XLogP | 6.30 |
| TPSA | 93.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 569.70 |
| LogP ≤ 5 | 6.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|