C37H46N4O5 — CID 139462412
N-cyclopentyl-3-[5-[7-methyl-9-oxo-5-[3-(4-propan-2-ylpiperazin-1-yl)propoxy]xanthen-3-yl]oxy-2-pyridinyl]propanamide (PubChem CID 139462412) has the molecular formula C37H46N4O5 and a molecular weight of 626.80 g/mol. Its IUPAC name is N-cyclopentyl-3-[5-[7-methyl-9-oxo-5-[3-(4-propan-2-ylpiperazin-1-yl)propoxy]xanthen-3-yl]oxy-2-pyridinyl]propanamide.
| Compound Name | N-cyclopentyl-3-[5-[7-methyl-9-oxo-5-[3-(4-propan-2-ylpiperazin-1-yl)propoxy]xanthen-3-yl]oxy-2-pyridinyl]propanamide |
|---|---|
| PubChem CID | 139462412 |
| Molecular Formula | C37H46N4O5 |
| Molecular Weight | 626.80 g/mol |
| Exact Mass | 626.35 |
| IUPAC Name | N-cyclopentyl-3-[5-[7-methyl-9-oxo-5-[3-(4-propan-2-ylpiperazin-1-yl)propoxy]xanthen-3-yl]oxy-2-pyridinyl]propanamide |
| SMILES | Cc1cc(OCCCN2CCN(C(C)C)CC2)c2oc3cc(Oc4ccc(CCC(=O)NC5CCCC5)nc4)ccc3c(=O)c2c1 |
| InChI | InChI=1S/C37H46N4O5/c1-25(2)41-18-16-40(17-19-41)15-6-20-44-34-22-26(3)21-32-36(43)31-13-12-29(23-33(31)46-37(32)34)45-30-11-9-27(38-24-30)10-14-35(42)39-28-7-4-5-8-28/h9,11-13,21-25,28H,4-8,10,14-20H2,1-3H3,(H,39,42) |
| InChIKey | AASWURPCYTVOKF-UHFFFAOYSA-N |
| XLogP | 6.23 |
| TPSA | 97.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 626.80 |
| LogP ≤ 5 | 6.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|