C31H36N4O5 — CID 139462487
4-[2-(dimethylamino)ethoxy]-2-methyl-6-[[6-[3-(4-methylpiperazin-1-yl)-3-oxopropyl]-3-pyridinyl]oxy]xanthen-9-one (PubChem CID 139462487) has the molecular formula C31H36N4O5 and a molecular weight of 544.65 g/mol. Its IUPAC name is 4-[2-(dimethylamino)ethoxy]-2-methyl-6-[[6-[3-(4-methylpiperazin-1-yl)-3-oxopropyl]-3-pyridinyl]oxy]xanthen-9-one.
| Compound Name | 4-[2-(dimethylamino)ethoxy]-2-methyl-6-[[6-[3-(4-methylpiperazin-1-yl)-3-oxopropyl]-3-pyridinyl]oxy]xanthen-9-one |
|---|---|
| PubChem CID | 139462487 |
| Molecular Formula | C31H36N4O5 |
| Molecular Weight | 544.65 g/mol |
| Exact Mass | 544.27 |
| IUPAC Name | 4-[2-(dimethylamino)ethoxy]-2-methyl-6-[[6-[3-(4-methylpiperazin-1-yl)-3-oxopropyl]-3-pyridinyl]oxy]xanthen-9-one |
| SMILES | Cc1cc(OCCN(C)C)c2oc3cc(Oc4ccc(CCC(=O)N5CCN(C)CC5)nc4)ccc3c(=O)c2c1 |
| InChI | InChI=1S/C31H36N4O5/c1-21-17-26-30(37)25-9-8-23(19-27(25)40-31(26)28(18-21)38-16-15-33(2)3)39-24-7-5-22(32-20-24)6-10-29(36)35-13-11-34(4)12-14-35/h5,7-9,17-20H,6,10-16H2,1-4H3 |
| InChIKey | PHXCGPSZGOZHLH-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 88.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.65 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|