C33H37N3O5 — CID 139462366
N-cyclopentyl-3-[5-[7-methyl-5-[(1-methylpyrrolidin-2-yl)methoxy]-9-oxoxanthen-3-yl]oxy-2-pyridinyl]propanamide (PubChem CID 139462366) has the molecular formula C33H37N3O5 and a molecular weight of 555.68 g/mol. Its IUPAC name is N-cyclopentyl-3-[5-[7-methyl-5-[(1-methylpyrrolidin-2-yl)methoxy]-9-oxoxanthen-3-yl]oxy-2-pyridinyl]propanamide.
| Compound Name | N-cyclopentyl-3-[5-[7-methyl-5-[(1-methylpyrrolidin-2-yl)methoxy]-9-oxoxanthen-3-yl]oxy-2-pyridinyl]propanamide |
|---|---|
| PubChem CID | 139462366 |
| Molecular Formula | C33H37N3O5 |
| Molecular Weight | 555.68 g/mol |
| Exact Mass | 555.27 |
| IUPAC Name | N-cyclopentyl-3-[5-[7-methyl-5-[(1-methylpyrrolidin-2-yl)methoxy]-9-oxoxanthen-3-yl]oxy-2-pyridinyl]propanamide |
| SMILES | Cc1cc(OCC2CCCN2C)c2oc3cc(Oc4ccc(CCC(=O)NC5CCCC5)nc4)ccc3c(=O)c2c1 |
| InChI | InChI=1S/C33H37N3O5/c1-21-16-28-32(38)27-13-12-25(18-29(27)41-33(28)30(17-21)39-20-24-8-5-15-36(24)2)40-26-11-9-22(34-19-26)10-14-31(37)35-23-6-3-4-7-23/h9,11-13,16-19,23-24H,3-8,10,14-15,20H2,1-2H3,(H,35,37) |
| InChIKey | PIFYQUSHIAJPQO-UHFFFAOYSA-N |
| XLogP | 5.91 |
| TPSA | 93.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 555.68 |
| LogP ≤ 5 | 5.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|