C18H18ClFN2O — CID 10544602
2-[6-chloro-1-(4-fluorophenyl)indol-3-yl]oxy-N,N-dimethylethanamine (PubChem CID 10544602) has the molecular formula C18H18ClFN2O and a molecular weight of 332.81 g/mol. Its IUPAC name is 2-[6-chloro-1-(4-fluorophenyl)indol-3-yl]oxy-N,N-dimethylethanamine.
| Compound Name | 2-[6-chloro-1-(4-fluorophenyl)indol-3-yl]oxy-N,N-dimethylethanamine |
|---|---|
| PubChem CID | 10544602 |
| Molecular Formula | C18H18ClFN2O |
| Molecular Weight | 332.81 g/mol |
| Exact Mass | 332.11 |
| IUPAC Name | 2-[6-chloro-1-(4-fluorophenyl)indol-3-yl]oxy-N,N-dimethylethanamine |
| SMILES | CN(C)CCOc1cn(-c2ccc(F)cc2)c2cc(Cl)ccc12 |
| InChI | InChI=1S/C18H18ClFN2O/c1-21(2)9-10-23-18-12-22(15-6-4-14(20)5-7-15)17-11-13(19)3-8-16(17)18/h3-8,11-12H,9-10H2,1-2H3 |
| InChIKey | ILXSTDBFYIRKOB-UHFFFAOYSA-N |
| XLogP | 4.36 |
| TPSA | 17.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.81 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |