C22H25ClFN3 — CID 14947118
2-[4-[6-chloro-1-(4-fluorophenyl)indol-3-yl]piperidin-1-yl]-N-methylethanamine (PubChem CID 14947118) has the molecular formula C22H25ClFN3 and a molecular weight of 385.91 g/mol. Its IUPAC name is 2-[4-[6-chloro-1-(4-fluorophenyl)indol-3-yl]piperidin-1-yl]-N-methylethanamine.
| Compound Name | 2-[4-[6-chloro-1-(4-fluorophenyl)indol-3-yl]piperidin-1-yl]-N-methylethanamine |
|---|---|
| PubChem CID | 14947118 |
| Molecular Formula | C22H25ClFN3 |
| Molecular Weight | 385.91 g/mol |
| Exact Mass | 385.17 |
| IUPAC Name | 2-[4-[6-chloro-1-(4-fluorophenyl)indol-3-yl]piperidin-1-yl]-N-methylethanamine |
| SMILES | CNCCN1CCC(c2cn(-c3ccc(F)cc3)c3cc(Cl)ccc23)CC1 |
| InChI | InChI=1S/C22H25ClFN3/c1-25-10-13-26-11-8-16(9-12-26)21-15-27(19-5-3-18(24)4-6-19)22-14-17(23)2-7-20(21)22/h2-7,14-16,25H,8-13H2,1H3 |
| InChIKey | UEAHRGZSAMMSPA-UHFFFAOYSA-N |
| XLogP | 4.82 |
| TPSA | 20.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.91 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |