C24H27ClFN3O2 — CID 19019545
ethyl N-[2-[4-[6-chloro-1-(4-fluorophenyl)indol-3-yl]piperidin-2-yl]ethyl]carbamate (PubChem CID 19019545) has the molecular formula C24H27ClFN3O2 and a molecular weight of 443.95 g/mol. Its IUPAC name is ethyl N-[2-[4-[6-chloro-1-(4-fluorophenyl)indol-3-yl]piperidin-2-yl]ethyl]carbamate.
| Compound Name | ethyl N-[2-[4-[6-chloro-1-(4-fluorophenyl)indol-3-yl]piperidin-2-yl]ethyl]carbamate |
|---|---|
| PubChem CID | 19019545 |
| Molecular Formula | C24H27ClFN3O2 |
| Molecular Weight | 443.95 g/mol |
| Exact Mass | 443.18 |
| IUPAC Name | ethyl N-[2-[4-[6-chloro-1-(4-fluorophenyl)indol-3-yl]piperidin-2-yl]ethyl]carbamate |
| SMILES | CCOC(=O)NCCC1CC(c2cn(-c3ccc(F)cc3)c3cc(Cl)ccc23)CCN1 |
| InChI | InChI=1S/C24H27ClFN3O2/c1-2-31-24(30)28-12-10-19-13-16(9-11-27-19)22-15-29(20-6-4-18(26)5-7-20)23-14-17(25)3-8-21(22)23/h3-8,14-16,19,27H,2,9-13H2,1H3,(H,28,30) |
| InChIKey | RZTSWXXVMCMONP-UHFFFAOYSA-N |
| XLogP | 5.39 |
| TPSA | 55.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.95 |
| LogP ≤ 5 | 5.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |