C27H32ClN3O3 — CID 121299328
tert-butyl N-[3-[4-[1-(4-chlorophenyl)indol-3-yl]piperidin-1-yl]-3-oxopropyl]carbamate (PubChem CID 121299328) has the molecular formula C27H32ClN3O3 and a molecular weight of 482.02 g/mol. Its IUPAC name is tert-butyl N-[3-[4-[1-(4-chlorophenyl)indol-3-yl]piperidin-1-yl]-3-oxopropyl]carbamate.
| Compound Name | tert-butyl N-[3-[4-[1-(4-chlorophenyl)indol-3-yl]piperidin-1-yl]-3-oxopropyl]carbamate |
|---|---|
| PubChem CID | 121299328 |
| Molecular Formula | C27H32ClN3O3 |
| Molecular Weight | 482.02 g/mol |
| Exact Mass | 481.21 |
| IUPAC Name | tert-butyl N-[3-[4-[1-(4-chlorophenyl)indol-3-yl]piperidin-1-yl]-3-oxopropyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NCCC(=O)N1CCC(c2cn(-c3ccc(Cl)cc3)c3ccccc23)CC1 |
| InChI | InChI=1S/C27H32ClN3O3/c1-27(2,3)34-26(33)29-15-12-25(32)30-16-13-19(14-17-30)23-18-31(21-10-8-20(28)9-11-21)24-7-5-4-6-22(23)24/h4-11,18-19H,12-17H2,1-3H3,(H,29,33) |
| InChIKey | VQHMPRKXBJLRIR-UHFFFAOYSA-N |
| XLogP | 5.90 |
| TPSA | 63.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.02 |
| LogP ≤ 5 | 5.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |