C24H32N4O4 — CID 108554769
tert-butyl N-[3-oxo-3-[4-[(4-pyrrol-1-ylbenzoyl)amino]piperidin-1-yl]propyl]carbamate (PubChem CID 108554769) has the molecular formula C24H32N4O4 and a molecular weight of 440.54 g/mol. Its IUPAC name is tert-butyl N-[3-oxo-3-[4-[(4-pyrrol-1-ylbenzoyl)amino]piperidin-1-yl]propyl]carbamate.
| Compound Name | tert-butyl N-[3-oxo-3-[4-[(4-pyrrol-1-ylbenzoyl)amino]piperidin-1-yl]propyl]carbamate |
|---|---|
| PubChem CID | 108554769 |
| Molecular Formula | C24H32N4O4 |
| Molecular Weight | 440.54 g/mol |
| Exact Mass | 440.24 |
| IUPAC Name | tert-butyl N-[3-oxo-3-[4-[(4-pyrrol-1-ylbenzoyl)amino]piperidin-1-yl]propyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NCCC(=O)N1CCC(NC(=O)c2ccc(-n3cccc3)cc2)CC1 |
| InChI | InChI=1S/C24H32N4O4/c1-24(2,3)32-23(31)25-13-10-21(29)28-16-11-19(12-17-28)26-22(30)18-6-8-20(9-7-18)27-14-4-5-15-27/h4-9,14-15,19H,10-13,16-17H2,1-3H3,(H,25,31)(H,26,30) |
| InChIKey | TWNSHLOMIYSYNW-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 92.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.54 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |