C20H31ClN3O4+ — CID 9475072
tert-butyl N-[3-[4-[2-(4-chlorophenoxy)ethyl]piperazin-4-ium-1-yl]-3-oxopropyl]carbamate (PubChem CID 9475072) has the molecular formula C20H31ClN3O4+ and a molecular weight of 412.94 g/mol. Its IUPAC name is tert-butyl N-[3-[4-[2-(4-chlorophenoxy)ethyl]piperazin-4-ium-1-yl]-3-oxopropyl]carbamate.
| Compound Name | tert-butyl N-[3-[4-[2-(4-chlorophenoxy)ethyl]piperazin-4-ium-1-yl]-3-oxopropyl]carbamate |
|---|---|
| PubChem CID | 9475072 |
| Molecular Formula | C20H31ClN3O4+ |
| Molecular Weight | 412.94 g/mol |
| Exact Mass | 412.20 |
| IUPAC Name | tert-butyl N-[3-[4-[2-(4-chlorophenoxy)ethyl]piperazin-4-ium-1-yl]-3-oxopropyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NCCC(=O)N1CC[NH+](CCOc2ccc(Cl)cc2)CC1 |
| InChI | InChI=1S/C20H30ClN3O4/c1-20(2,3)28-19(26)22-9-8-18(25)24-12-10-23(11-13-24)14-15-27-17-6-4-16(21)5-7-17/h4-7H,8-15H2,1-3H3,(H,22,26)/p+1 |
| InChIKey | VZQIEPOCHRRPRG-UHFFFAOYSA-O |
| XLogP | 1.36 |
| TPSA | 72.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.94 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |