C18H27ClN2O4 — CID 55406068
tert-butyl N-[4-[2-(4-chlorophenoxy)ethyl-methylamino]-4-oxobutyl]carbamate (PubChem CID 55406068) has the molecular formula C18H27ClN2O4 and a molecular weight of 370.88 g/mol. Its IUPAC name is tert-butyl N-[4-[2-(4-chlorophenoxy)ethyl-methylamino]-4-oxobutyl]carbamate.
| Compound Name | tert-butyl N-[4-[2-(4-chlorophenoxy)ethyl-methylamino]-4-oxobutyl]carbamate |
|---|---|
| PubChem CID | 55406068 |
| Molecular Formula | C18H27ClN2O4 |
| Molecular Weight | 370.88 g/mol |
| Exact Mass | 370.17 |
| IUPAC Name | tert-butyl N-[4-[2-(4-chlorophenoxy)ethyl-methylamino]-4-oxobutyl]carbamate |
| SMILES | CN(CCOc1ccc(Cl)cc1)C(=O)CCCNC(=O)OC(C)(C)C |
| InChI | InChI=1S/C18H27ClN2O4/c1-18(2,3)25-17(23)20-11-5-6-16(22)21(4)12-13-24-15-9-7-14(19)8-10-15/h7-10H,5-6,11-13H2,1-4H3,(H,20,23) |
| InChIKey | DEUICPNZWKVPNC-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.88 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|