C25H31ClFN3O2 — CID 19379857
N-[1-[4-[6-chloro-1-(4-fluorophenyl)indol-3-yl]piperidin-1-yl]ethyl]-1,1-dimethoxyethanamine (PubChem CID 19379857) has the molecular formula C25H31ClFN3O2 and a molecular weight of 459.99 g/mol. Its IUPAC name is N-[1-[4-[6-chloro-1-(4-fluorophenyl)indol-3-yl]piperidin-1-yl]ethyl]-1,1-dimethoxyethanamine.
| Compound Name | N-[1-[4-[6-chloro-1-(4-fluorophenyl)indol-3-yl]piperidin-1-yl]ethyl]-1,1-dimethoxyethanamine |
|---|---|
| PubChem CID | 19379857 |
| Molecular Formula | C25H31ClFN3O2 |
| Molecular Weight | 459.99 g/mol |
| Exact Mass | 459.21 |
| IUPAC Name | N-[1-[4-[6-chloro-1-(4-fluorophenyl)indol-3-yl]piperidin-1-yl]ethyl]-1,1-dimethoxyethanamine |
| SMILES | COC(C)(NC(C)N1CCC(c2cn(-c3ccc(F)cc3)c3cc(Cl)ccc23)CC1)OC |
| InChI | InChI=1S/C25H31ClFN3O2/c1-17(28-25(2,31-3)32-4)29-13-11-18(12-14-29)23-16-30(21-8-6-20(27)7-9-21)24-15-19(26)5-10-22(23)24/h5-10,15-18,28H,11-14H2,1-4H3 |
| InChIKey | HIESNPCUKRHBCH-UHFFFAOYSA-N |
| XLogP | 5.50 |
| TPSA | 38.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.99 |
| LogP ≤ 5 | 5.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|