C21H23Cl2FN2O — CID 139829310
2-[4-[6-chloro-1-(4-fluorophenyl)indol-3-yl]piperidin-1-yl]ethanol;hydrochloride (PubChem CID 139829310) has the molecular formula C21H23Cl2FN2O and a molecular weight of 409.33 g/mol. Its IUPAC name is 2-[4-[6-chloro-1-(4-fluorophenyl)indol-3-yl]piperidin-1-yl]ethanol;hydrochloride.
| Compound Name | 2-[4-[6-chloro-1-(4-fluorophenyl)indol-3-yl]piperidin-1-yl]ethanol;hydrochloride |
|---|---|
| PubChem CID | 139829310 |
| Molecular Formula | C21H23Cl2FN2O |
| Molecular Weight | 409.33 g/mol |
| Exact Mass | 408.12 |
| IUPAC Name | 2-[4-[6-chloro-1-(4-fluorophenyl)indol-3-yl]piperidin-1-yl]ethanol;hydrochloride |
| SMILES | Cl.OCCN1CCC(c2cn(-c3ccc(F)cc3)c3cc(Cl)ccc23)CC1 |
| InChI | InChI=1S/C21H22ClFN2O.ClH/c22-16-1-6-19-20(15-7-9-24(10-8-15)11-12-26)14-25(21(19)13-16)18-4-2-17(23)3-5-18;/h1-6,13-15,26H,7-12H2;1H |
| InChIKey | DQIDJVQFEJZXSB-UHFFFAOYSA-N |
| XLogP | 5.02 |
| TPSA | 28.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.33 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |