C19H18BrClN2O2 — CID 142901021
(4-bromophenyl)-[5-chloro-3-[2-(dimethylamino)ethoxy]indol-1-yl]methanone (PubChem CID 142901021) has the molecular formula C19H18BrClN2O2 and a molecular weight of 421.72 g/mol. Its IUPAC name is (4-bromophenyl)-[5-chloro-3-[2-(dimethylamino)ethoxy]indol-1-yl]methanone.
| Compound Name | (4-bromophenyl)-[5-chloro-3-[2-(dimethylamino)ethoxy]indol-1-yl]methanone |
|---|---|
| PubChem CID | 142901021 |
| Molecular Formula | C19H18BrClN2O2 |
| Molecular Weight | 421.72 g/mol |
| Exact Mass | 420.02 |
| IUPAC Name | (4-bromophenyl)-[5-chloro-3-[2-(dimethylamino)ethoxy]indol-1-yl]methanone |
| SMILES | CN(C)CCOc1cn(C(=O)c2ccc(Br)cc2)c2ccc(Cl)cc12 |
| InChI | InChI=1S/C19H18BrClN2O2/c1-22(2)9-10-25-18-12-23(17-8-7-15(21)11-16(17)18)19(24)13-3-5-14(20)6-4-13/h3-8,11-12H,9-10H2,1-2H3 |
| InChIKey | QLZMZERSOQQKEK-UHFFFAOYSA-N |
| XLogP | 4.69 |
| TPSA | 34.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.72 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |