C22H24ClFN2O5 — CID 19065947
1-[5-chloro-1-(4-fluorophenyl)indol-3-yl]oxy-N,N,2-trimethylpropan-2-amine;oxalic acid (PubChem CID 19065947) has the molecular formula C22H24ClFN2O5 and a molecular weight of 450.89 g/mol. Its IUPAC name is 1-[5-chloro-1-(4-fluorophenyl)indol-3-yl]oxy-N,N,2-trimethylpropan-2-amine;oxalic acid.
| Compound Name | 1-[5-chloro-1-(4-fluorophenyl)indol-3-yl]oxy-N,N,2-trimethylpropan-2-amine;oxalic acid |
|---|---|
| PubChem CID | 19065947 |
| Molecular Formula | C22H24ClFN2O5 |
| Molecular Weight | 450.89 g/mol |
| Exact Mass | 450.14 |
| IUPAC Name | 1-[5-chloro-1-(4-fluorophenyl)indol-3-yl]oxy-N,N,2-trimethylpropan-2-amine;oxalic acid |
| SMILES | CN(C)C(C)(C)COc1cn(-c2ccc(F)cc2)c2ccc(Cl)cc12.O=C(O)C(=O)O |
| InChI | InChI=1S/C20H22ClFN2O.C2H2O4/c1-20(2,23(3)4)13-25-19-12-24(16-8-6-15(22)7-9-16)18-10-5-14(21)11-17(18)19;3-1(4)2(5)6/h5-12H,13H2,1-4H3;(H,3,4)(H,5,6) |
| InChIKey | LLZPPGGFFGBEOB-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 92.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.89 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|