About argon;4-(4-chlorophenoxy)benzonitrile
argon;4-(4-chlorophenoxy)benzonitrile (PubChem CID 158538207) has the molecular formula C13H8ArClNO
and a molecular weight of 269.61 g/mol. Its IUPAC name is argon;4-(4-chlorophenoxy)benzonitrile.
Molecular Properties
| Compound Name | argon;4-(4-chlorophenoxy)benzonitrile |
| PubChem CID | 158538207 |
| Molecular Formula | C13H8ArClNO |
| Molecular Weight | 269.61 g/mol |
| Exact Mass | 268.99 |
| IUPAC Name | argon;4-(4-chlorophenoxy)benzonitrile |
| SMILES | N#Cc1ccc(Oc2ccc(Cl)cc2)cc1.[Ar] |
| InChI | InChI=1S/C13H8ClNO.Ar/c14-11-3-7-13(8-4-11)16-12-5-1-10(9-15)2-6-12;/h1-8H; |
| InChIKey | HOEVZWMUFMIQSB-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 33.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 269.61 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze argon;4-(4-chlorophenoxy)benzonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of argon;4-(4-chlorophenoxy)benzonitrile?
The IUPAC name of argon;4-(4-chlorophenoxy)benzonitrile (CID 158538207) is argon;4-(4-chlorophenoxy)benzonitrile.
What is the SMILES notation for argon;4-(4-chlorophenoxy)benzonitrile?
The canonical SMILES for argon;4-(4-chlorophenoxy)benzonitrile is N#Cc1ccc(Oc2ccc(Cl)cc2)cc1.[Ar].
What is the InChIKey of argon;4-(4-chlorophenoxy)benzonitrile?
The InChIKey is HOEVZWMUFMIQSB-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H8ClNO.Ar/c14-11-3-7-13(8-4-11)16-12-5-1-10(9-15)2-6-12;/h1-8H;.
What are the key properties of argon;4-(4-chlorophenoxy)benzonitrile?
argon;4-(4-chlorophenoxy)benzonitrile has a molecular weight of 269.61 g/mol, XLogP of 4.00, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for argon;4-(4-chlorophenoxy)benzonitrile is sourced from PubChem (CID 158538207), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).