C10H4Cl2N4O — CID 58974961
4-[(4,6-dichloro-1,3,5-triazin-2-yl)oxy]benzonitrile (PubChem CID 58974961) has the molecular formula C10H4Cl2N4O and a molecular weight of 267.08 g/mol. Its IUPAC name is 4-[(4,6-dichloro-1,3,5-triazin-2-yl)oxy]benzonitrile.
| Compound Name | 4-[(4,6-dichloro-1,3,5-triazin-2-yl)oxy]benzonitrile |
|---|---|
| PubChem CID | 58974961 |
| Molecular Formula | C10H4Cl2N4O |
| Molecular Weight | 267.08 g/mol |
| Exact Mass | 265.98 |
| IUPAC Name | 4-[(4,6-dichloro-1,3,5-triazin-2-yl)oxy]benzonitrile |
| SMILES | N#Cc1ccc(Oc2nc(Cl)nc(Cl)n2)cc1 |
| InChI | InChI=1S/C10H4Cl2N4O/c11-8-14-9(12)16-10(15-8)17-7-3-1-6(5-13)2-4-7/h1-4H |
| InChIKey | JPQBNSXEMHZMLY-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 71.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.08 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |