C25H13N5O3 — CID 10717549
4-[2,6-bis(4-cyanophenoxy)pyrimidin-4-yl]oxybenzonitrile (PubChem CID 10717549) has the molecular formula C25H13N5O3 and a molecular weight of 431.41 g/mol. Its IUPAC name is 4-[2,6-bis(4-cyanophenoxy)pyrimidin-4-yl]oxybenzonitrile.
| Compound Name | 4-[2,6-bis(4-cyanophenoxy)pyrimidin-4-yl]oxybenzonitrile |
|---|---|
| PubChem CID | 10717549 |
| Molecular Formula | C25H13N5O3 |
| Molecular Weight | 431.41 g/mol |
| Exact Mass | 431.10 |
| IUPAC Name | 4-[2,6-bis(4-cyanophenoxy)pyrimidin-4-yl]oxybenzonitrile |
| SMILES | N#Cc1ccc(Oc2cc(Oc3ccc(C#N)cc3)nc(Oc3ccc(C#N)cc3)n2)cc1 |
| InChI | InChI=1S/C25H13N5O3/c26-14-17-1-7-20(8-2-17)31-23-13-24(32-21-9-3-18(15-27)4-10-21)30-25(29-23)33-22-11-5-19(16-28)6-12-22/h1-13H |
| InChIKey | HWRAEMQFSLOVQA-UHFFFAOYSA-N |
| XLogP | 5.47 |
| TPSA | 124.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.41 |
| LogP ≤ 5 | 5.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |