C22H14N4O3 — CID 162501099
4-[(4,6-diphenoxy-1,3,5-triazin-2-yl)oxy]benzonitrile (PubChem CID 162501099) has the molecular formula C22H14N4O3 and a molecular weight of 382.38 g/mol. Its IUPAC name is 4-[(4,6-diphenoxy-1,3,5-triazin-2-yl)oxy]benzonitrile.
| Compound Name | 4-[(4,6-diphenoxy-1,3,5-triazin-2-yl)oxy]benzonitrile |
|---|---|
| PubChem CID | 162501099 |
| Molecular Formula | C22H14N4O3 |
| Molecular Weight | 382.38 g/mol |
| Exact Mass | 382.11 |
| IUPAC Name | 4-[(4,6-diphenoxy-1,3,5-triazin-2-yl)oxy]benzonitrile |
| SMILES | N#Cc1ccc(Oc2nc(Oc3ccccc3)nc(Oc3ccccc3)n2)cc1 |
| InChI | InChI=1S/C22H14N4O3/c23-15-16-11-13-19(14-12-16)29-22-25-20(27-17-7-3-1-4-8-17)24-21(26-22)28-18-9-5-2-6-10-18/h1-14H |
| InChIKey | IWELAQCBFHBWJL-UHFFFAOYSA-N |
| XLogP | 5.12 |
| TPSA | 90.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.38 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |