C23H15N5O4 — CID 71538731
3-[[4-(4-cyanophenoxy)-6-phenoxy-1,3,5-triazin-2-yl]amino]benzoic acid (PubChem CID 71538731) has the molecular formula C23H15N5O4 and a molecular weight of 425.40 g/mol. Its IUPAC name is 3-[[4-(4-cyanophenoxy)-6-phenoxy-1,3,5-triazin-2-yl]amino]benzoic acid.
| Compound Name | 3-[[4-(4-cyanophenoxy)-6-phenoxy-1,3,5-triazin-2-yl]amino]benzoic acid |
|---|---|
| PubChem CID | 71538731 |
| Molecular Formula | C23H15N5O4 |
| Molecular Weight | 425.40 g/mol |
| Exact Mass | 425.11 |
| IUPAC Name | 3-[[4-(4-cyanophenoxy)-6-phenoxy-1,3,5-triazin-2-yl]amino]benzoic acid |
| SMILES | N#Cc1ccc(Oc2nc(Nc3cccc(C(=O)O)c3)nc(Oc3ccccc3)n2)cc1 |
| InChI | InChI=1S/C23H15N5O4/c24-14-15-9-11-19(12-10-15)32-23-27-21(25-17-6-4-5-16(13-17)20(29)30)26-22(28-23)31-18-7-2-1-3-8-18/h1-13H,(H,29,30)(H,25,26,27,28) |
| InChIKey | DSGWZRQTWKZQLU-UHFFFAOYSA-N |
| XLogP | 4.77 |
| TPSA | 130.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.40 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |