C9H7N3O3S2 — CID 145326243
2-phenoxy-4,6-bis(sulfanyloxy)-1,3,5-triazine (PubChem CID 145326243) has the molecular formula C9H7N3O3S2 and a molecular weight of 269.31 g/mol. Its IUPAC name is 2-phenoxy-4,6-bis(sulfanyloxy)-1,3,5-triazine.
| Compound Name | 2-phenoxy-4,6-bis(sulfanyloxy)-1,3,5-triazine |
|---|---|
| PubChem CID | 145326243 |
| Molecular Formula | C9H7N3O3S2 |
| Molecular Weight | 269.31 g/mol |
| Exact Mass | 268.99 |
| IUPAC Name | 2-phenoxy-4,6-bis(sulfanyloxy)-1,3,5-triazine |
| SMILES | SOc1nc(OS)nc(Oc2ccccc2)n1 |
| InChI | InChI=1S/C9H7N3O3S2/c16-14-8-10-7(11-9(12-8)15-17)13-6-4-2-1-3-5-6/h1-5,16-17H |
| InChIKey | VKQHYSFXPIGIPH-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 66.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.31 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|