C15H15N3O3 — CID 71407181
2-phenoxy-4,6-bis(prop-2-enoxy)-1,3,5-triazine (PubChem CID 71407181) has the molecular formula C15H15N3O3 and a molecular weight of 285.30 g/mol. Its IUPAC name is 2-phenoxy-4,6-bis(prop-2-enoxy)-1,3,5-triazine.
| Compound Name | 2-phenoxy-4,6-bis(prop-2-enoxy)-1,3,5-triazine |
|---|---|
| PubChem CID | 71407181 |
| Molecular Formula | C15H15N3O3 |
| Molecular Weight | 285.30 g/mol |
| Exact Mass | 285.11 |
| IUPAC Name | 2-phenoxy-4,6-bis(prop-2-enoxy)-1,3,5-triazine |
| SMILES | C=CCOc1nc(OCC=C)nc(Oc2ccccc2)n1 |
| InChI | InChI=1S/C15H15N3O3/c1-3-10-19-13-16-14(20-11-4-2)18-15(17-13)21-12-8-6-5-7-9-12/h3-9H,1-2,10-11H2 |
| InChIKey | SXZZDJCUUZAYRC-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 66.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.30 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|