C21H23NO2 — CID 10519814
5-phenoxy-2-prop-2-enoxy-N,N-bis(prop-2-enyl)aniline (PubChem CID 10519814) has the molecular formula C21H23NO2 and a molecular weight of 321.42 g/mol. Its IUPAC name is 5-phenoxy-2-prop-2-enoxy-N,N-bis(prop-2-enyl)aniline.
| Compound Name | 5-phenoxy-2-prop-2-enoxy-N,N-bis(prop-2-enyl)aniline |
|---|---|
| PubChem CID | 10519814 |
| Molecular Formula | C21H23NO2 |
| Molecular Weight | 321.42 g/mol |
| Exact Mass | 321.17 |
| IUPAC Name | 5-phenoxy-2-prop-2-enoxy-N,N-bis(prop-2-enyl)aniline |
| SMILES | C=CCOc1ccc(Oc2ccccc2)cc1N(CC=C)CC=C |
| InChI | InChI=1S/C21H23NO2/c1-4-14-22(15-5-2)20-17-19(12-13-21(20)23-16-6-3)24-18-10-8-7-9-11-18/h4-13,17H,1-3,14-16H2 |
| InChIKey | MFVVRWCRSPRLCO-UHFFFAOYSA-N |
| XLogP | 5.22 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.42 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|